C21H25ClN2O2 — CID 55334565
4-chloro-N-[4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]benzamide (PubChem CID 55334565) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 4-chloro-N-[4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 55334565 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-chloro-N-[4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)cc1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H25ClN2O2/c1-15(2)14-19(24-20(25)17-8-10-18(22)11-9-17)21(26)23-13-12-16-6-4-3-5-7-16/h3-11,15,19H,12-14H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | AYGSVSRIEDOIAE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |