C16H19ClN2O3 — CID 7648864
[(1R)-1-cyanoethyl] (2S)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate (PubChem CID 7648864) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] (2S)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate.
| Compound Name | [(1R)-1-cyanoethyl] (2S)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 7648864 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [(1R)-1-cyanoethyl] (2S)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)O[C@H](C)C#N |
| InChI | InChI=1S/C16H19ClN2O3/c1-10(2)8-14(16(21)22-11(3)9-18)19-15(20)12-4-6-13(17)7-5-12/h4-7,10-11,14H,8H2,1-3H3,(H,19,20)/t11-,14+/m1/s1 |
| InChIKey | CSZXQQASWBQIDQ-RISCZKNCSA-N |
| XLogP | 2.94 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |