C19H26N2O3S — CID 7982728
[(1S)-1-cyanoethyl] (2R)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 7982728) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] (2R)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | [(1S)-1-cyanoethyl] (2R)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7982728 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(1S)-1-cyanoethyl] (2R)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)O[C@@H](C)C#N |
| InChI | InChI=1S/C19H26N2O3S/c1-13(12-20)24-18(23)16(10-11-25-5)21-17(22)14-6-8-15(9-7-14)19(2,3)4/h6-9,13,16H,10-11H2,1-5H3,(H,21,22)/t13-,16+/m0/s1 |
| InChIKey | XOKAQWPDJYWFJS-XJKSGUPXSA-N |
| XLogP | 3.29 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |