C22H33N3O6S — CID 40944063
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 40944063) has the molecular formula C22H33N3O6S and a molecular weight of 467.59 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 40944063 |
| Molecular Formula | C22H33N3O6S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)[C@H](CCSC)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H33N3O6S/c1-22(2,3)16-8-6-15(7-9-16)19(27)24-17(10-13-32-5)20(28)31-14-18(26)25-21(29)23-11-12-30-4/h6-9,17H,10-14H2,1-5H3,(H,24,27)(H2,23,25,26,29)/t17-/m0/s1 |
| InChIKey | NXYYFBJIEJPOGQ-KRWDZBQOSA-N |
| XLogP | 1.85 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|