C20H29N3O5 — CID 8882512
[2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 8882512) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8882512 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)[C@H](C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29N3O5/c1-6-11-21-19(27)23-16(24)12-28-18(26)13(2)22-17(25)14-7-9-15(10-8-14)20(3,4)5/h7-10,13H,6,11-12H2,1-5H3,(H,22,25)(H2,21,23,24,27)/t13-/m0/s1 |
| InChIKey | OHBATYVSZGHOSG-ZDUSSCGKSA-N |
| XLogP | 1.88 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |