C19H25N3O6 — CID 55326576
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate (PubChem CID 55326576) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 55326576 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)C(C)NC(=O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H25N3O6/c1-4-11-20-19(26)22-17(24)12-28-18(25)13(2)21-16(23)10-7-14-5-8-15(27-3)9-6-14/h5-10,13H,4,11-12H2,1-3H3,(H,21,23)(H2,20,22,24,26) |
| InChIKey | DTGLRVOBRFYBSY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|