C21H21FN2O5 — CID 55326489
[2-(3-fluoroanilino)-2-oxoethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate (PubChem CID 55326489) has the molecular formula C21H21FN2O5 and a molecular weight of 400.41 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 55326489 |
| Molecular Formula | C21H21FN2O5 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
| SMILES | COc1ccc(C=CC(=O)NC(C)C(=O)OCC(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H21FN2O5/c1-14(23-19(25)11-8-15-6-9-18(28-2)10-7-15)21(27)29-13-20(26)24-17-5-3-4-16(22)12-17/h3-12,14H,13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | SKDNKRNEMXSCDZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|