C22H25N3O7S — CID 55927542
[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 55927542) has the molecular formula C22H25N3O7S and a molecular weight of 475.52 g/mol. Its IUPAC name is [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 55927542 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | COc1ccc(/C=C/C(=O)N[C@@H](C)C(=O)OCC(=O)Nc2ccc(C)c(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C22H25N3O7S/c1-14-4-8-17(12-19(14)33(23,29)30)25-21(27)13-32-22(28)15(2)24-20(26)11-7-16-5-9-18(31-3)10-6-16/h4-12,15H,13H2,1-3H3,(H,24,26)(H,25,27)(H2,23,29,30)/b11-7+/t15-/m0/s1 |
| InChIKey | AUJMNJKCSCXBKJ-USYSOWRXSA-N |
| XLogP | 1.35 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|