C18H20N2O4S — CID 9141198
(E)-3-(4-ethoxyphenyl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide (PubChem CID 9141198) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9141198 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2ccc(C)c(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-3-24-16-9-5-14(6-10-16)7-11-18(21)20-15-8-4-13(2)17(12-15)25(19,22)23/h4-12H,3H2,1-2H3,(H,20,21)(H2,19,22,23)/b11-7+ |
| InChIKey | IGFXFQUMMIXCIJ-YRNVUSSQSA-N |
| XLogP | 2.69 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|