C25H23N3O4S — CID 26852058
(E)-3-(4-cyanophenyl)-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]prop-2-enamide (PubChem CID 26852058) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is (E)-3-(4-cyanophenyl)-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-cyanophenyl)-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26852058 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (E)-3-(4-cyanophenyl)-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]prop-2-enamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(NC(=O)/C=C/c3ccc(C#N)cc3)ccc2C)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-3-32-23-13-11-21(12-14-23)28-33(30,31)24-16-22(10-4-18(24)2)27-25(29)15-9-19-5-7-20(17-26)8-6-19/h4-16,28H,3H2,1-2H3,(H,27,29)/b15-9+ |
| InChIKey | NFXOWDRXTGTPAC-OQLLNIDSSA-N |
| XLogP | 4.72 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|