C25H24N2O7S — CID 6065136
(E)-3-(1,3-benzodioxol-5-yl)-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]prop-2-enamide (PubChem CID 6065136) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6065136 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]prop-2-enamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(NC(=O)/C=C/c3ccc4c(c3)OCO4)ccc2OC)cc1 |
| InChI | InChI=1S/C25H24N2O7S/c1-3-32-20-9-6-18(7-10-20)27-35(29,30)24-15-19(8-12-22(24)31-2)26-25(28)13-5-17-4-11-21-23(14-17)34-16-33-21/h4-15,27H,3,16H2,1-2H3,(H,26,28)/b13-5+ |
| InChIKey | VJQYRHZHRQHVGW-WLRTZDKTSA-N |
| XLogP | 4.28 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|