C28H27N3O8S2 — CID 4844550
3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 4844550) has the molecular formula C28H27N3O8S2 and a molecular weight of 597.67 g/mol. Its IUPAC name is 3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | 3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4844550 |
| Molecular Formula | C28H27N3O8S2 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | 3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)C=Cc3ccc(S(=O)(=O)NCc4ccco4)cc3)ccc2OC)cc1 |
| InChI | InChI=1S/C28H27N3O8S2/c1-37-23-11-8-21(9-12-23)31-41(35,36)27-18-22(10-15-26(27)38-2)30-28(32)16-7-20-5-13-25(14-6-20)40(33,34)29-19-24-4-3-17-39-24/h3-18,29,31H,19H2,1-2H3,(H,30,32) |
| InChIKey | WTSTTYBCMWALAF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|