C22H20F2N2O6S — CID 26590181
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 26590181) has the molecular formula C22H20F2N2O6S and a molecular weight of 478.47 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26590181 |
| Molecular Formula | C22H20F2N2O6S |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(S(=O)(=O)NCc3ccco3)c2)ccc1OC(F)F |
| InChI | InChI=1S/C22H20F2N2O6S/c1-30-20-12-15(7-9-19(20)32-22(23)24)8-10-21(27)26-16-4-2-6-18(13-16)33(28,29)25-14-17-5-3-11-31-17/h2-13,22,25H,14H2,1H3,(H,26,27)/b10-8+ |
| InChIKey | LOWHHNUENWIXRE-CSKARUKUSA-N |
| XLogP | 4.02 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|