C20H18F2N2O6S — CID 55342860
2-(difluoromethoxy)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-3-methoxybenzamide (PubChem CID 55342860) has the molecular formula C20H18F2N2O6S and a molecular weight of 452.44 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-3-methoxybenzamide.
| Compound Name | 2-(difluoromethoxy)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 55342860 |
| Molecular Formula | C20H18F2N2O6S |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2-(difluoromethoxy)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(S(=O)(=O)NCc3ccco3)c2)c1OC(F)F |
| InChI | InChI=1S/C20H18F2N2O6S/c1-28-17-9-3-8-16(18(17)30-20(21)22)19(25)24-13-5-2-7-15(11-13)31(26,27)23-12-14-6-4-10-29-14/h2-11,20,23H,12H2,1H3,(H,24,25) |
| InChIKey | WMSHRTATHNZVIG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |