C24H22FN3O4S — CID 46798356
1-(4-fluorophenyl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 46798356) has the molecular formula C24H22FN3O4S and a molecular weight of 467.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46798356 |
| Molecular Formula | C24H22FN3O4S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(S(=O)(=O)NCc3ccco3)c2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FN3O4S/c1-16-13-23(17(2)28(16)20-10-8-18(25)9-11-20)24(29)27-19-5-3-7-22(14-19)33(30,31)26-15-21-6-4-12-32-21/h3-14,26H,15H2,1-2H3,(H,27,29) |
| InChIKey | JFOHZJCHZCGHFJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|