C18H13F3N2O4S — CID 4115156
N-(3,4-difluorophenyl)-2-fluoro-5-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 4115156) has the molecular formula C18H13F3N2O4S and a molecular weight of 410.37 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-fluoro-5-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(3,4-difluorophenyl)-2-fluoro-5-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 4115156 |
| Molecular Formula | C18H13F3N2O4S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-fluoro-5-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1cc(S(=O)(=O)NCc2ccco2)ccc1F |
| InChI | InChI=1S/C18H13F3N2O4S/c19-15-6-4-13(28(25,26)22-10-12-2-1-7-27-12)9-14(15)18(24)23-11-3-5-16(20)17(21)8-11/h1-9,22H,10H2,(H,23,24) |
| InChIKey | NIYPQRPERQWIOG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |