C18H14Cl2N2O4S — CID 25036124
2-chloro-N-(4-chlorophenyl)-5-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 25036124) has the molecular formula C18H14Cl2N2O4S and a molecular weight of 425.29 g/mol. Its IUPAC name is 2-chloro-N-(4-chlorophenyl)-5-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-(4-chlorophenyl)-5-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 25036124 |
| Molecular Formula | C18H14Cl2N2O4S |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 2-chloro-N-(4-chlorophenyl)-5-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)NCc2ccco2)ccc1Cl |
| InChI | InChI=1S/C18H14Cl2N2O4S/c19-12-3-5-13(6-4-12)22-18(23)16-10-15(7-8-17(16)20)27(24,25)21-11-14-2-1-9-26-14/h1-10,21H,11H2,(H,22,23) |
| InChIKey | VSXSGMJSTDJLMO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |