C19H16Cl2N2O5S — CID 17105937
2-(2,4-dichlorophenoxy)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 17105937) has the molecular formula C19H16Cl2N2O5S and a molecular weight of 455.32 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17105937 |
| Molecular Formula | C19H16Cl2N2O5S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O5S/c20-13-3-8-18(17(21)10-13)28-12-19(24)23-14-4-6-16(7-5-14)29(25,26)22-11-15-2-1-9-27-15/h1-10,22H,11-12H2,(H,23,24) |
| InChIKey | QAYCNXIDJMUWRX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |