C22H21Cl2N3O5S2 — CID 17171038
4-(2,4-dichlorophenoxy)-N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]butanamide (PubChem CID 17171038) has the molecular formula C22H21Cl2N3O5S2 and a molecular weight of 542.47 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 17171038 |
| Molecular Formula | C22H21Cl2N3O5S2 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NC(=S)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C22H21Cl2N3O5S2/c23-15-5-10-20(19(24)13-15)32-12-2-4-21(28)27-22(33)26-16-6-8-18(9-7-16)34(29,30)25-14-17-3-1-11-31-17/h1,3,5-11,13,25H,2,4,12,14H2,(H2,26,27,28,33) |
| InChIKey | ZHOSZMYFKZFOHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|