C19H18Cl2N2O4S — CID 19188469
methyl 3-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]benzoate (PubChem CID 19188469) has the molecular formula C19H18Cl2N2O4S and a molecular weight of 441.34 g/mol. Its IUPAC name is methyl 3-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]benzoate.
| Compound Name | methyl 3-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 19188469 |
| Molecular Formula | C19H18Cl2N2O4S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | methyl 3-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NC(=O)CCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N2O4S/c1-26-18(25)12-4-2-5-14(10-12)22-19(28)23-17(24)6-3-9-27-16-8-7-13(20)11-15(16)21/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H2,22,23,24,28) |
| InChIKey | FJULOMLABFDIJW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|