C22H24Cl2N2O4S — CID 19188471
butyl 4-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]benzoate (PubChem CID 19188471) has the molecular formula C22H24Cl2N2O4S and a molecular weight of 483.42 g/mol. Its IUPAC name is butyl 4-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]benzoate.
| Compound Name | butyl 4-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 19188471 |
| Molecular Formula | C22H24Cl2N2O4S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | butyl 4-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=S)NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H24Cl2N2O4S/c1-2-3-12-30-21(28)15-6-9-17(10-7-15)25-22(31)26-20(27)5-4-13-29-19-11-8-16(23)14-18(19)24/h6-11,14H,2-5,12-13H2,1H3,(H2,25,26,27,31) |
| InChIKey | KNFXPYTWWLIQDC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|