C23H28N2O4S — CID 19188377
pentyl 4-(4-phenoxybutanoylcarbamothioylamino)benzoate (PubChem CID 19188377) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is pentyl 4-(4-phenoxybutanoylcarbamothioylamino)benzoate.
| Compound Name | pentyl 4-(4-phenoxybutanoylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19188377 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | pentyl 4-(4-phenoxybutanoylcarbamothioylamino)benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=S)NC(=O)CCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-2-3-7-16-29-22(27)18-12-14-19(15-13-18)24-23(30)25-21(26)11-8-17-28-20-9-5-4-6-10-20/h4-6,9-10,12-15H,2-3,7-8,11,16-17H2,1H3,(H2,24,25,26,30) |
| InChIKey | JRQBKIQWFQKXSB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|