C20H30N2O3S — CID 19189211
hexyl 4-(3,3-dimethylbutanoylcarbamothioylamino)benzoate (PubChem CID 19189211) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is hexyl 4-(3,3-dimethylbutanoylcarbamothioylamino)benzoate.
| Compound Name | hexyl 4-(3,3-dimethylbutanoylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19189211 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | hexyl 4-(3,3-dimethylbutanoylcarbamothioylamino)benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC(=S)NC(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H30N2O3S/c1-5-6-7-8-13-25-18(24)15-9-11-16(12-10-15)21-19(26)22-17(23)14-20(2,3)4/h9-12H,5-8,13-14H2,1-4H3,(H2,21,22,23,26) |
| InChIKey | GESCTRPACXTFPC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|