C16H22N2O3S — CID 19189202
ethyl 4-(3,3-dimethylbutanoylcarbamothioylamino)benzoate (PubChem CID 19189202) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 4-(3,3-dimethylbutanoylcarbamothioylamino)benzoate.
| Compound Name | ethyl 4-(3,3-dimethylbutanoylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19189202 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | ethyl 4-(3,3-dimethylbutanoylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O3S/c1-5-21-14(20)11-6-8-12(9-7-11)17-15(22)18-13(19)10-16(2,3)4/h6-9H,5,10H2,1-4H3,(H2,17,18,19,22) |
| InChIKey | WPIOGGWQMGDWJU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|