C19H19BrN2O4S — CID 3377359
ethyl 4-[[2-(4-bromo-3-methylphenoxy)acetyl]carbamothioylamino]benzoate (PubChem CID 3377359) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is ethyl 4-[[2-(4-bromo-3-methylphenoxy)acetyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[2-(4-bromo-3-methylphenoxy)acetyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 3377359 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | ethyl 4-[[2-(4-bromo-3-methylphenoxy)acetyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC(=O)COc2ccc(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C19H19BrN2O4S/c1-3-25-18(24)13-4-6-14(7-5-13)21-19(27)22-17(23)11-26-15-8-9-16(20)12(2)10-15/h4-10H,3,11H2,1-2H3,(H2,21,22,23,27) |
| InChIKey | DHIPCUVBIALNBO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|