C17H17BrN4O3S — CID 4511455
2-(4-bromo-3-methylphenoxy)-N-[(phenylcarbamoylamino)carbamothioyl]acetamide (PubChem CID 4511455) has the molecular formula C17H17BrN4O3S and a molecular weight of 437.32 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-N-[(phenylcarbamoylamino)carbamothioyl]acetamide.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-N-[(phenylcarbamoylamino)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4511455 |
| Molecular Formula | C17H17BrN4O3S |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-N-[(phenylcarbamoylamino)carbamothioyl]acetamide |
| SMILES | Cc1cc(OCC(=O)NC(=S)NNC(=O)Nc2ccccc2)ccc1Br |
| InChI | InChI=1S/C17H17BrN4O3S/c1-11-9-13(7-8-14(11)18)25-10-15(23)20-17(26)22-21-16(24)19-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H2,19,21,24)(H2,20,22,23,26) |
| InChIKey | MPWPAFOYRWKPSG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|