C22H25BrN4O4S — CID 3352101
N-[4-[[[2-(4-bromo-3-methylphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide (PubChem CID 3352101) has the molecular formula C22H25BrN4O4S and a molecular weight of 521.44 g/mol. Its IUPAC name is N-[4-[[[2-(4-bromo-3-methylphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[[[2-(4-bromo-3-methylphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3352101 |
| Molecular Formula | C22H25BrN4O4S |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | N-[4-[[[2-(4-bromo-3-methylphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide |
| SMILES | Cc1cc(OCC(=O)NC(=S)NNC(=O)c2ccc(NC(=O)CC(C)C)cc2)ccc1Br |
| InChI | InChI=1S/C22H25BrN4O4S/c1-13(2)10-19(28)24-16-6-4-15(5-7-16)21(30)26-27-22(32)25-20(29)12-31-17-8-9-18(23)14(3)11-17/h4-9,11,13H,10,12H2,1-3H3,(H,24,28)(H,26,30)(H2,25,27,29,32) |
| InChIKey | RTNUPCSLLIJSSG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|