C16H16BrN3O4S2 — CID 3378855
2-(4-bromo-3-methylphenoxy)-N-[(4-sulfamoylphenyl)carbamothioyl]acetamide (PubChem CID 3378855) has the molecular formula C16H16BrN3O4S2 and a molecular weight of 458.36 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-N-[(4-sulfamoylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-N-[(4-sulfamoylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3378855 |
| Molecular Formula | C16H16BrN3O4S2 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-N-[(4-sulfamoylphenyl)carbamothioyl]acetamide |
| SMILES | Cc1cc(OCC(=O)NC(=S)Nc2ccc(S(N)(=O)=O)cc2)ccc1Br |
| InChI | InChI=1S/C16H16BrN3O4S2/c1-10-8-12(4-7-14(10)17)24-9-15(21)20-16(25)19-11-2-5-13(6-3-11)26(18,22)23/h2-8H,9H2,1H3,(H2,18,22,23)(H2,19,20,21,25) |
| InChIKey | VIJKQLSNBAMDGY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|