C24H24BrN3O4S2 — CID 3383248
2-(4-bromo-3-methylphenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide (PubChem CID 3383248) has the molecular formula C24H24BrN3O4S2 and a molecular weight of 562.51 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3383248 |
| Molecular Formula | C24H24BrN3O4S2 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)COc3ccc(Br)c(C)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H24BrN3O4S2/c1-15-4-11-22(17(3)12-15)28-34(30,31)20-8-5-18(6-9-20)26-24(33)27-23(29)14-32-19-7-10-21(25)16(2)13-19/h4-13,28H,14H2,1-3H3,(H2,26,27,29,33) |
| InChIKey | ZAUPGOMYJGSXLO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|