C23H22BrN3O4S2 — CID 3347596
2-(4-bromophenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide (PubChem CID 3347596) has the molecular formula C23H22BrN3O4S2 and a molecular weight of 548.48 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3347596 |
| Molecular Formula | C23H22BrN3O4S2 |
| Molecular Weight | 548.48 g/mol |
| Exact Mass | 547.02 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)COc3ccc(Br)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H22BrN3O4S2/c1-15-3-12-21(16(2)13-15)27-33(29,30)20-10-6-18(7-11-20)25-23(32)26-22(28)14-31-19-8-4-17(24)5-9-19/h3-13,27H,14H2,1-2H3,(H2,25,26,28,32) |
| InChIKey | REUIETUJKHHQMK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|