C22H20BrN3O3S2 — CID 54791735
3-bromo-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 54791735) has the molecular formula C22H20BrN3O3S2 and a molecular weight of 518.46 g/mol. Its IUPAC name is 3-bromo-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54791735 |
| Molecular Formula | C22H20BrN3O3S2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | 3-bromo-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cccc(Br)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H20BrN3O3S2/c1-14-6-11-20(15(2)12-14)26-31(28,29)19-9-7-18(8-10-19)24-22(30)25-21(27)16-4-3-5-17(23)13-16/h3-13,26H,1-2H3,(H2,24,25,27,30) |
| InChIKey | SNORIFJLBYIJRC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|