C21H19IN2O3S — CID 98112403
N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-3-iodobenzamide (PubChem CID 98112403) has the molecular formula C21H19IN2O3S and a molecular weight of 506.37 g/mol. Its IUPAC name is N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-3-iodobenzamide.
| Compound Name | N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 98112403 |
| Molecular Formula | C21H19IN2O3S |
| Molecular Weight | 506.37 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-3-iodobenzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(I)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H19IN2O3S/c1-14-6-11-20(15(2)12-14)24-28(26,27)19-9-7-18(8-10-19)23-21(25)16-4-3-5-17(22)13-16/h3-13,24H,1-2H3,(H,23,25) |
| InChIKey | WSEGMSCANGVOME-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|