C21H19IN2O5S — CID 100513297
N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-3-iodobenzamide (PubChem CID 100513297) has the molecular formula C21H19IN2O5S and a molecular weight of 538.36 g/mol. Its IUPAC name is N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-3-iodobenzamide.
| Compound Name | N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 100513297 |
| Molecular Formula | C21H19IN2O5S |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-3-iodobenzamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2ccc(NC(=O)c3cccc(I)c3)cc2)c1 |
| InChI | InChI=1S/C21H19IN2O5S/c1-28-17-8-11-20(29-2)19(13-17)24-30(26,27)18-9-6-16(7-10-18)23-21(25)14-4-3-5-15(22)12-14/h3-13,24H,1-2H3,(H,23,25) |
| InChIKey | MTOOCSMJCZLGEM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|