C15H17N3O5S — CID 100657262
N-(2,5-dimethoxyphenyl)-3-(hydrazinecarbonyl)benzenesulfonamide (PubChem CID 100657262) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-(hydrazinecarbonyl)benzenesulfonamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-(hydrazinecarbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100657262 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-(hydrazinecarbonyl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2cccc(C(=O)NN)c2)c1 |
| InChI | InChI=1S/C15H17N3O5S/c1-22-11-6-7-14(23-2)13(9-11)18-24(20,21)12-5-3-4-10(8-12)15(19)17-16/h3-9,18H,16H2,1-2H3,(H,17,19) |
| InChIKey | FADXNFJUXUTCNU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|