C15H14NO6S- — CID 4060147
4-[(2,5-dimethoxyphenyl)sulfamoyl]benzoate (PubChem CID 4060147) has the molecular formula C15H14NO6S- and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)sulfamoyl]benzoate.
| Compound Name | 4-[(2,5-dimethoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4060147 |
| Molecular Formula | C15H14NO6S- |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2ccc(C(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C15H15NO6S/c1-21-11-5-8-14(22-2)13(9-11)16-23(19,20)12-6-3-10(4-7-12)15(17)18/h3-9,16H,1-2H3,(H,17,18)/p-1 |
| InChIKey | QBXLRDDXGGQAPR-UHFFFAOYSA-M |
| XLogP | 0.87 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |