C15H15NO5S — CID 4126284
4-methoxy-3-[(4-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 4126284) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is 4-methoxy-3-[(4-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-methoxy-3-[(4-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 4126284 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-methoxy-3-[(4-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H15NO5S/c1-10-3-6-12(7-4-10)22(19,20)16-13-9-11(15(17)18)5-8-14(13)21-2/h3-9,16H,1-2H3,(H,17,18) |
| InChIKey | MNYIMRMULIOECO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |