C21H18Cl2N2O4S — CID 18626096
3,4-dichloro-N-[4-methoxy-3-[(4-methylphenyl)sulfonylamino]phenyl]benzamide (PubChem CID 18626096) has the molecular formula C21H18Cl2N2O4S and a molecular weight of 465.36 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-methoxy-3-[(4-methylphenyl)sulfonylamino]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-methoxy-3-[(4-methylphenyl)sulfonylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 18626096 |
| Molecular Formula | C21H18Cl2N2O4S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 3,4-dichloro-N-[4-methoxy-3-[(4-methylphenyl)sulfonylamino]phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)cc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O4S/c1-13-3-7-16(8-4-13)30(27,28)25-19-12-15(6-10-20(19)29-2)24-21(26)14-5-9-17(22)18(23)11-14/h3-12,25H,1-2H3,(H,24,26) |
| InChIKey | KDXHQXAHRNXQET-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |