C20H16Cl2N2O4S — CID 18626240
3-[(3,4-dichlorophenyl)sulfonylamino]-4-methoxy-N-phenylbenzamide (PubChem CID 18626240) has the molecular formula C20H16Cl2N2O4S and a molecular weight of 451.33 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)sulfonylamino]-4-methoxy-N-phenylbenzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-4-methoxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 18626240 |
| Molecular Formula | C20H16Cl2N2O4S |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-4-methoxy-N-phenylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N2O4S/c1-28-19-10-7-13(20(25)23-14-5-3-2-4-6-14)11-18(19)24-29(26,27)15-8-9-16(21)17(22)12-15/h2-12,24H,1H3,(H,23,25) |
| InChIKey | BWPGLLYYDRJPDD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |