C22H18Cl2N2O7S — CID 11977883
4-[[3-[(3,4-dichlorophenyl)sulfonylamino]-4,5-dimethoxybenzoyl]amino]benzoic acid (PubChem CID 11977883) has the molecular formula C22H18Cl2N2O7S and a molecular weight of 525.37 g/mol. Its IUPAC name is 4-[[3-[(3,4-dichlorophenyl)sulfonylamino]-4,5-dimethoxybenzoyl]amino]benzoic acid.
| Compound Name | 4-[[3-[(3,4-dichlorophenyl)sulfonylamino]-4,5-dimethoxybenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11977883 |
| Molecular Formula | C22H18Cl2N2O7S |
| Molecular Weight | 525.37 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | 4-[[3-[(3,4-dichlorophenyl)sulfonylamino]-4,5-dimethoxybenzoyl]amino]benzoic acid |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)O)cc2)cc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1OC |
| InChI | InChI=1S/C22H18Cl2N2O7S/c1-32-19-10-13(21(27)25-14-5-3-12(4-6-14)22(28)29)9-18(20(19)33-2)26-34(30,31)15-7-8-16(23)17(24)11-15/h3-11,26H,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | KWFXPHFQXSUTSU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |