3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid

C13H13NO6S2 — CID 167759672

IUPAC3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid
SMILESCOc1cc(C(=O)O)cc(NS(=O)(=O)c2ccsc2)c1OC
InChIInChI=1S/C13H13NO6S2/c1-19-11-6-8(13(15)16)5-10(12(11)20-2)14-22(17,18)9-3-4-21-7-9/h3-7,14H,1-2H3,(H,15,16)
InChIKeyJHDZPYNEDHOTBG-UHFFFAOYSA-N
MW343.38 g/mol
LogP2.26
Rot. Bonds6

About 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid

3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid (PubChem CID 167759672) has the molecular formula C13H13NO6S2 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid.

Molecular Properties

Compound Name3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid
PubChem CID167759672
Molecular FormulaC13H13NO6S2
Molecular Weight343.38 g/mol
Exact Mass343.02
IUPAC Name3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid
SMILESCOc1cc(C(=O)O)cc(NS(=O)(=O)c2ccsc2)c1OC
InChIInChI=1S/C13H13NO6S2/c1-19-11-6-8(13(15)16)5-10(12(11)20-2)14-22(17,18)9-3-4-21-7-9/h3-7,14H,1-2H3,(H,15,16)
InChIKeyJHDZPYNEDHOTBG-UHFFFAOYSA-N
XLogP2.26
TPSA101.93 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.38
LogP ≤ 52.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid?
The IUPAC name of 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid (CID 167759672) is 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid.
What is the SMILES notation for 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid?
The canonical SMILES for 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid is COc1cc(C(=O)O)cc(NS(=O)(=O)c2ccsc2)c1OC.
What is the InChIKey of 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid?
The InChIKey is JHDZPYNEDHOTBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO6S2/c1-19-11-6-8(13(15)16)5-10(12(11)20-2)14-22(17,18)9-3-4-21-7-9/h3-7,14H,1-2H3,(H,15,16).
What are the key properties of 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid?
3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid has a molecular weight of 343.38 g/mol, XLogP of 2.26, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid is sourced from PubChem (CID 167759672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).