C13H13NO6S2 — CID 167759672
3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid (PubChem CID 167759672) has the molecular formula C13H13NO6S2 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid.
| Compound Name | 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 167759672 |
| Molecular Formula | C13H13NO6S2 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 3,4-dimethoxy-5-(thiophen-3-ylsulfonylamino)benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NS(=O)(=O)c2ccsc2)c1OC |
| InChI | InChI=1S/C13H13NO6S2/c1-19-11-6-8(13(15)16)5-10(12(11)20-2)14-22(17,18)9-3-4-21-7-9/h3-7,14H,1-2H3,(H,15,16) |
| InChIKey | JHDZPYNEDHOTBG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |