C14H15NO4S — CID 167943258
3,4-dimethoxy-5-(thiophen-3-ylmethylamino)benzoic acid (PubChem CID 167943258) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 3,4-dimethoxy-5-(thiophen-3-ylmethylamino)benzoic acid.
| Compound Name | 3,4-dimethoxy-5-(thiophen-3-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 167943258 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3,4-dimethoxy-5-(thiophen-3-ylmethylamino)benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NCc2ccsc2)c1OC |
| InChI | InChI=1S/C14H15NO4S/c1-18-12-6-10(14(16)17)5-11(13(12)19-2)15-7-9-3-4-20-8-9/h3-6,8,15H,7H2,1-2H3,(H,16,17) |
| InChIKey | QVGBMUQYVXPNED-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |