C21H25NO6 — CID 119214278
3-[[2-(4-tert-butylphenoxy)acetyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 119214278) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-[[2-(4-tert-butylphenoxy)acetyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 3-[[2-(4-tert-butylphenoxy)acetyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 119214278 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-[[2-(4-tert-butylphenoxy)acetyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NC(=O)COc2ccc(C(C)(C)C)cc2)c1OC |
| InChI | InChI=1S/C21H25NO6/c1-21(2,3)14-6-8-15(9-7-14)28-12-18(23)22-16-10-13(20(24)25)11-17(26-4)19(16)27-5/h6-11H,12H2,1-5H3,(H,22,23)(H,24,25) |
| InChIKey | KCUZVRSZPHGRSV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |