C19H21NO6 — CID 119214379
3,4-dimethoxy-5-[[2-(2-phenylethoxy)acetyl]amino]benzoic acid (PubChem CID 119214379) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3,4-dimethoxy-5-[[2-(2-phenylethoxy)acetyl]amino]benzoic acid.
| Compound Name | 3,4-dimethoxy-5-[[2-(2-phenylethoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 119214379 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3,4-dimethoxy-5-[[2-(2-phenylethoxy)acetyl]amino]benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NC(=O)COCCc2ccccc2)c1OC |
| InChI | InChI=1S/C19H21NO6/c1-24-16-11-14(19(22)23)10-15(18(16)25-2)20-17(21)12-26-9-8-13-6-4-3-5-7-13/h3-7,10-11H,8-9,12H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | DUUOLAXTRKWAGY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|