C21H25NO5 — CID 120521326
3,4-dimethoxy-5-[(4-methyl-4-phenylpentanoyl)amino]benzoic acid (PubChem CID 120521326) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 3,4-dimethoxy-5-[(4-methyl-4-phenylpentanoyl)amino]benzoic acid.
| Compound Name | 3,4-dimethoxy-5-[(4-methyl-4-phenylpentanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 120521326 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3,4-dimethoxy-5-[(4-methyl-4-phenylpentanoyl)amino]benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NC(=O)CCC(C)(C)c2ccccc2)c1OC |
| InChI | InChI=1S/C21H25NO5/c1-21(2,15-8-6-5-7-9-15)11-10-18(23)22-16-12-14(20(24)25)13-17(26-3)19(16)27-4/h5-9,12-13H,10-11H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | JELLJMZTISANEW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |