C17H25NO5 — CID 119214383
3-(5,5-dimethylhexanoylamino)-4,5-dimethoxybenzoic acid (PubChem CID 119214383) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-(5,5-dimethylhexanoylamino)-4,5-dimethoxybenzoic acid.
| Compound Name | 3-(5,5-dimethylhexanoylamino)-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 119214383 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-(5,5-dimethylhexanoylamino)-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NC(=O)CCCC(C)(C)C)c1OC |
| InChI | InChI=1S/C17H25NO5/c1-17(2,3)8-6-7-14(19)18-12-9-11(16(20)21)10-13(22-4)15(12)23-5/h9-10H,6-8H2,1-5H3,(H,18,19)(H,20,21) |
| InChIKey | LTFDUEAMDUHZBM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |