C17H23NO5 — CID 166390559
4-[(6,6-dimethyl-5-oxoheptanoyl)amino]-3-methoxybenzoic acid (PubChem CID 166390559) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-[(6,6-dimethyl-5-oxoheptanoyl)amino]-3-methoxybenzoic acid.
| Compound Name | 4-[(6,6-dimethyl-5-oxoheptanoyl)amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 166390559 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 4-[(6,6-dimethyl-5-oxoheptanoyl)amino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)CCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H23NO5/c1-17(2,3)14(19)6-5-7-15(20)18-12-9-8-11(16(21)22)10-13(12)23-4/h8-10H,5-7H2,1-4H3,(H,18,20)(H,21,22) |
| InChIKey | KDNWIBLMMAGDND-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |