C15H22N2O5 — CID 119803077
methyl 3,4-dimethoxy-5-[4-(methylamino)butanoylamino]benzoate (PubChem CID 119803077) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl 3,4-dimethoxy-5-[4-(methylamino)butanoylamino]benzoate.
| Compound Name | methyl 3,4-dimethoxy-5-[4-(methylamino)butanoylamino]benzoate |
|---|---|
| PubChem CID | 119803077 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | methyl 3,4-dimethoxy-5-[4-(methylamino)butanoylamino]benzoate |
| SMILES | CNCCCC(=O)Nc1cc(C(=O)OC)cc(OC)c1OC |
| InChI | InChI=1S/C15H22N2O5/c1-16-7-5-6-13(18)17-11-8-10(15(19)22-4)9-12(20-2)14(11)21-3/h8-9,16H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | GMAGAANNPLFASB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|