C15H23ClN2O5 — CID 119677751
methyl 4,5-dimethoxy-2-[4-(methylamino)butanoylamino]benzoate;hydrochloride (PubChem CID 119677751) has the molecular formula C15H23ClN2O5 and a molecular weight of 346.81 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[4-(methylamino)butanoylamino]benzoate;hydrochloride.
| Compound Name | methyl 4,5-dimethoxy-2-[4-(methylamino)butanoylamino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119677751 |
| Molecular Formula | C15H23ClN2O5 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[4-(methylamino)butanoylamino]benzoate;hydrochloride |
| SMILES | CNCCCC(=O)Nc1cc(OC)c(OC)cc1C(=O)OC.Cl |
| InChI | InChI=1S/C15H22N2O5.ClH/c1-16-7-5-6-14(18)17-11-9-13(21-3)12(20-2)8-10(11)15(19)22-4;/h8-9,16H,5-7H2,1-4H3,(H,17,18);1H |
| InChIKey | QGTXQZOQRBXYRF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|