C15H22N2O6 — CID 120586654
methyl 2-[(4-amino-3-methoxybutanoyl)amino]-4,5-dimethoxybenzoate (PubChem CID 120586654) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl 2-[(4-amino-3-methoxybutanoyl)amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(4-amino-3-methoxybutanoyl)amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 120586654 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | methyl 2-[(4-amino-3-methoxybutanoyl)amino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)CC(CN)OC |
| InChI | InChI=1S/C15H22N2O6/c1-20-9(8-16)5-14(18)17-11-7-13(22-3)12(21-2)6-10(11)15(19)23-4/h6-7,9H,5,8,16H2,1-4H3,(H,17,18) |
| InChIKey | DXKUCQGFKYNABB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |