C17H27Cl2N3O5 — CID 120595061
methyl 2-[(4-amino-3-methoxybutanoyl)amino]-5-morpholin-4-ylbenzoate;dihydrochloride (PubChem CID 120595061) has the molecular formula C17H27Cl2N3O5 and a molecular weight of 424.33 g/mol. Its IUPAC name is methyl 2-[(4-amino-3-methoxybutanoyl)amino]-5-morpholin-4-ylbenzoate;dihydrochloride.
| Compound Name | methyl 2-[(4-amino-3-methoxybutanoyl)amino]-5-morpholin-4-ylbenzoate;dihydrochloride |
|---|---|
| PubChem CID | 120595061 |
| Molecular Formula | C17H27Cl2N3O5 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | methyl 2-[(4-amino-3-methoxybutanoyl)amino]-5-morpholin-4-ylbenzoate;dihydrochloride |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)CC(CN)OC.Cl.Cl |
| InChI | InChI=1S/C17H25N3O5.2ClH/c1-23-13(11-18)10-16(21)19-15-4-3-12(9-14(15)17(22)24-2)20-5-7-25-8-6-20;;/h3-4,9,13H,5-8,10-11,18H2,1-2H3,(H,19,21);2*1H |
| InChIKey | FQGLPOZWNGYLQN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |